C15H15BrClNO5S2 — CID 155597983
5-bromo-N-(5-chloro-2-hydroxy-3-propan-2-ylsulfinylphenyl)-2-hydroxybenzenesulfonamide (PubChem CID 155597983) has the molecular formula C15H15BrClNO5S2 and a molecular weight of 468.78 g/mol. Its IUPAC name is 5-bromo-N-(5-chloro-2-hydroxy-3-propan-2-ylsulfinylphenyl)-2-hydroxybenzenesulfonamide.
| Compound Name | 5-bromo-N-(5-chloro-2-hydroxy-3-propan-2-ylsulfinylphenyl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 155597983 |
| Molecular Formula | C15H15BrClNO5S2 |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | 5-bromo-N-(5-chloro-2-hydroxy-3-propan-2-ylsulfinylphenyl)-2-hydroxybenzenesulfonamide |
| SMILES | CC(C)S(=O)c1cc(Cl)cc(NS(=O)(=O)c2cc(Br)ccc2O)c1O |
| InChI | InChI=1S/C15H15BrClNO5S2/c1-8(2)24(21)13-7-10(17)6-11(15(13)20)18-25(22,23)14-5-9(16)3-4-12(14)19/h3-8,18-20H,1-2H3 |
| InChIKey | FHGSQJRPPORWQT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|