C15H14BrFN2O6S — CID 155597958
3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide (PubChem CID 155597958) has the molecular formula C15H14BrFN2O6S and a molecular weight of 449.25 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 155597958 |
| Molecular Formula | C15H14BrFN2O6S |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1cc(F)cc(NS(=O)(=O)c2cc(Br)ccc2O)c1O |
| InChI | InChI=1S/C15H14BrFN2O6S/c16-8-1-2-12(21)13(5-8)26(24,25)19-11-7-9(17)6-10(14(11)22)15(23)18-3-4-20/h1-2,5-7,19-22H,3-4H2,(H,18,23) |
| InChIKey | YYFABLUADWLKJD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|