C20H23BrN2O6S — CID 155598100
3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-cyclopropyl-2-hydroxy-N-(2-methoxyethyl)-N-methylbenzamide (PubChem CID 155598100) has the molecular formula C20H23BrN2O6S and a molecular weight of 499.38 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-cyclopropyl-2-hydroxy-N-(2-methoxyethyl)-N-methylbenzamide.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-cyclopropyl-2-hydroxy-N-(2-methoxyethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 155598100 |
| Molecular Formula | C20H23BrN2O6S |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-cyclopropyl-2-hydroxy-N-(2-methoxyethyl)-N-methylbenzamide |
| SMILES | COCCN(C)C(=O)c1cc(C2CC2)cc(NS(=O)(=O)c2cc(Br)ccc2O)c1O |
| InChI | InChI=1S/C20H23BrN2O6S/c1-23(7-8-29-2)20(26)15-9-13(12-3-4-12)10-16(19(15)25)22-30(27,28)18-11-14(21)5-6-17(18)24/h5-6,9-12,22,24-25H,3-4,7-8H2,1-2H3 |
| InChIKey | KGJCKRPXROXOAF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|