C14H12BrFN2O5S — CID 155597881
3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-methylbenzamide (PubChem CID 155597881) has the molecular formula C14H12BrFN2O5S and a molecular weight of 419.23 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-methylbenzamide.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 155597881 |
| Molecular Formula | C14H12BrFN2O5S |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-fluoro-2-hydroxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(F)cc(NS(=O)(=O)c2cc(Br)ccc2O)c1O |
| InChI | InChI=1S/C14H12BrFN2O5S/c1-17-14(21)9-5-8(16)6-10(13(9)20)18-24(22,23)12-4-7(15)2-3-11(12)19/h2-6,18-20H,1H3,(H,17,21) |
| InChIKey | SGPUBKXQELDRDG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|