C19H15BrClN3O6S — CID 155598088
3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide (PubChem CID 155598088) has the molecular formula C19H15BrClN3O6S and a molecular weight of 528.77 g/mol. Its IUPAC name is 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide.
| Compound Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 155598088 |
| Molecular Formula | C19H15BrClN3O6S |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 526.96 |
| IUPAC Name | 3-[(5-bromo-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(=O)[nH]c1)c1cc(Cl)cc(NS(=O)(=O)c2cc(Br)ccc2O)c1O |
| InChI | InChI=1S/C19H15BrClN3O6S/c20-11-2-3-15(25)16(5-11)31(29,30)24-14-7-12(21)6-13(18(14)27)19(28)23-9-10-1-4-17(26)22-8-10/h1-8,24-25,27H,9H2,(H,22,26)(H,23,28) |
| InChIKey | TUSHWPIWYXCASA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|