C16H12BrF2NO6S — CID 155597857
5-[(5-bromo-3-fluoro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxybenzoic acid (PubChem CID 155597857) has the molecular formula C16H12BrF2NO6S and a molecular weight of 464.24 g/mol. Its IUPAC name is 5-[(5-bromo-3-fluoro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxybenzoic acid.
| Compound Name | 5-[(5-bromo-3-fluoro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 155597857 |
| Molecular Formula | C16H12BrF2NO6S |
| Molecular Weight | 464.24 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | 5-[(5-bromo-3-fluoro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)c(NS(=O)(=O)c2cc(Br)cc(F)c2O)cc(C2CC2)c1F |
| InChI | InChI=1S/C16H12BrF2NO6S/c17-7-3-9(18)14(21)11(4-7)27(25,26)20-10-5-8(6-1-2-6)13(19)12(15(10)22)16(23)24/h3-6,20-22H,1-2H2,(H,23,24) |
| InChIKey | AFOPJVFZPVJNRW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|