C14H13NO3Y — CID 59524620
N-(5,8-dihydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium (PubChem CID 59524620) has the molecular formula C14H13NO3Y and a molecular weight of 332.17 g/mol. Its IUPAC name is N-(5,8-dihydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium.
| Compound Name | N-(5,8-dihydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium |
|---|---|
| PubChem CID | 59524620 |
| Molecular Formula | C14H13NO3Y |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | N-(5,8-dihydroxynaphthalen-1-yl)-2-methylprop-2-enamide;yttrium |
| SMILES | C=C(C)C(=O)Nc1cccc2c(O)ccc(O)c12.[Y] |
| InChI | InChI=1S/C14H13NO3.Y/c1-8(2)14(18)15-10-5-3-4-9-11(16)6-7-12(17)13(9)10;/h3-7,16-17H,1H2,2H3,(H,15,18); |
| InChIKey | FAXVXLVTTSPYIX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|