C14H14ClF2NO3 — CID 103209921
N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-3-(2,2-difluoroethoxy)propanamide (PubChem CID 103209921) has the molecular formula C14H14ClF2NO3 and a molecular weight of 317.72 g/mol. Its IUPAC name is N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-3-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-3-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 103209921 |
| Molecular Formula | C14H14ClF2NO3 |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-[4-chloro-2-(3-hydroxyprop-1-ynyl)phenyl]-3-(2,2-difluoroethoxy)propanamide |
| SMILES | O=C(CCOCC(F)F)Nc1ccc(Cl)cc1C#CCO |
| InChI | InChI=1S/C14H14ClF2NO3/c15-11-3-4-12(10(8-11)2-1-6-19)18-14(20)5-7-21-9-13(16)17/h3-4,8,13,19H,5-7,9H2,(H,18,20) |
| InChIKey | IBDJBURJKAUXRD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|