4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid

C14H19NO6 — CID 107937657

IUPAC4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid
SMILESCCCOCC(=O)Nc1cc(OC)c(OC)cc1C(=O)O
InChIInChI=1S/C14H19NO6/c1-4-5-21-8-13(16)15-10-7-12(20-3)11(19-2)6-9(10)14(17)18/h6-7H,4-5,8H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyKINBMCAHWLGJFK-UHFFFAOYSA-N
MW297.31 g/mol
LogP1.77
Rot. Bonds8

About 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid

4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid (PubChem CID 107937657) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid.

Molecular Properties

Compound Name4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid
PubChem CID107937657
Molecular FormulaC14H19NO6
Molecular Weight297.31 g/mol
Exact Mass297.12
IUPAC Name4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid
SMILESCCCOCC(=O)Nc1cc(OC)c(OC)cc1C(=O)O
InChIInChI=1S/C14H19NO6/c1-4-5-21-8-13(16)15-10-7-12(20-3)11(19-2)6-9(10)14(17)18/h6-7H,4-5,8H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyKINBMCAHWLGJFK-UHFFFAOYSA-N
XLogP1.77
TPSA94.09 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.31
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid?
The IUPAC name of 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid (CID 107937657) is 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid.
What is the SMILES notation for 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid?
The canonical SMILES for 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid is CCCOCC(=O)Nc1cc(OC)c(OC)cc1C(=O)O.
What is the InChIKey of 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid?
The InChIKey is KINBMCAHWLGJFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO6/c1-4-5-21-8-13(16)15-10-7-12(20-3)11(19-2)6-9(10)14(17)18/h6-7H,4-5,8H2,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid?
4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid has a molecular weight of 297.31 g/mol, XLogP of 1.77, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-2-[(2-propoxyacetyl)amino]benzoic acid is sourced from PubChem (CID 107937657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).