C22H21Cl2NO7 — CID 44570869
2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 44570869) has the molecular formula C22H21Cl2NO7 and a molecular weight of 482.32 g/mol. Its IUPAC name is 2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 44570869 |
| Molecular Formula | C22H21Cl2NO7 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)Nc2cc(OC)c(OC)cc2C(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C22H21Cl2NO7/c1-5-11(2)21(27)12-6-7-15(20(24)19(12)23)32-10-18(26)25-14-9-17(31-4)16(30-3)8-13(14)22(28)29/h6-9H,2,5,10H2,1,3-4H3,(H,25,26)(H,28,29) |
| InChIKey | NCYWPXMVSBCUTJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|