C16H18Cl2O3 — CID 130432604
1-[2,3-dichloro-4-(3-methyl-2-oxobutoxy)phenyl]-2-methylidenebutan-1-one (PubChem CID 130432604) has the molecular formula C16H18Cl2O3 and a molecular weight of 329.22 g/mol. Its IUPAC name is 1-[2,3-dichloro-4-(3-methyl-2-oxobutoxy)phenyl]-2-methylidenebutan-1-one.
| Compound Name | 1-[2,3-dichloro-4-(3-methyl-2-oxobutoxy)phenyl]-2-methylidenebutan-1-one |
|---|---|
| PubChem CID | 130432604 |
| Molecular Formula | C16H18Cl2O3 |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-[2,3-dichloro-4-(3-methyl-2-oxobutoxy)phenyl]-2-methylidenebutan-1-one |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)C(C)C)c(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl2O3/c1-5-10(4)16(20)11-6-7-13(15(18)14(11)17)21-8-12(19)9(2)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | JGIZRRDPULLKDF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|