C18H20Cl2N2O6 — CID 154732718
(1-amino-2-methyl-1-oxopropan-2-yl) N-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]carbamate (PubChem CID 154732718) has the molecular formula C18H20Cl2N2O6 and a molecular weight of 431.27 g/mol. Its IUPAC name is (1-amino-2-methyl-1-oxopropan-2-yl) N-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]carbamate.
| Compound Name | (1-amino-2-methyl-1-oxopropan-2-yl) N-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]carbamate |
|---|---|
| PubChem CID | 154732718 |
| Molecular Formula | C18H20Cl2N2O6 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | (1-amino-2-methyl-1-oxopropan-2-yl) N-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]carbamate |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)NC(=O)OC(C)(C)C(N)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C18H20Cl2N2O6/c1-5-9(2)15(24)10-6-7-11(14(20)13(10)19)27-8-12(23)22-17(26)28-18(3,4)16(21)25/h6-7H,2,5,8H2,1,3-4H3,(H2,21,25)(H,22,23,26) |
| InChIKey | WYDGCJTUSQAGJG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|