C17H20Cl2N2O4 — CID 118407790
N-(2-acetamidoethyl)-2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetamide (PubChem CID 118407790) has the molecular formula C17H20Cl2N2O4 and a molecular weight of 387.26 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 118407790 |
| Molecular Formula | C17H20Cl2N2O4 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetamide |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)NCCNC(C)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C17H20Cl2N2O4/c1-4-10(2)17(24)12-5-6-13(16(19)15(12)18)25-9-14(23)21-8-7-20-11(3)22/h5-6H,2,4,7-9H2,1,3H3,(H,20,22)(H,21,23) |
| InChIKey | ANMVOPMENUFFRW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|