C17H20Cl2O3 — CID 58554656
1-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-3,3-dimethylbutan-2-one (PubChem CID 58554656) has the molecular formula C17H20Cl2O3 and a molecular weight of 343.25 g/mol. Its IUPAC name is 1-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 58554656 |
| Molecular Formula | C17H20Cl2O3 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-3,3-dimethylbutan-2-one |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)C(C)(C)C)c(Cl)c1Cl |
| InChI | InChI=1S/C17H20Cl2O3/c1-6-10(2)16(21)11-7-8-12(15(19)14(11)18)22-9-13(20)17(3,4)5/h7-8H,2,6,9H2,1,3-5H3 |
| InChIKey | QZXGWWGEMIHPCD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|