C25H28Cl2O12 — CID 138688678
(2S)-2-[(2S)-2-[(2S)-2-[(2S)-2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid (PubChem CID 138688678) has the molecular formula C25H28Cl2O12 and a molecular weight of 591.39 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-[(2S)-2-[(2S)-2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid.
| Compound Name | (2S)-2-[(2S)-2-[(2S)-2-[(2S)-2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 138688678 |
| Molecular Formula | C25H28Cl2O12 |
| Molecular Weight | 591.39 g/mol |
| Exact Mass | 590.10 |
| IUPAC Name | (2S)-2-[(2S)-2-[(2S)-2-[(2S)-2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)O[C@@H](C)C(=O)O[C@@H](C)C(=O)O[C@@H](C)C(=O)O[C@@H](C)C(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C25H28Cl2O12/c1-7-11(2)21(29)16-8-9-17(20(27)19(16)26)35-10-18(28)36-13(4)23(32)38-15(6)25(34)39-14(5)24(33)37-12(3)22(30)31/h8-9,12-15H,2,7,10H2,1,3-6H3,(H,30,31)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | NWQOVOSEBFUQJL-AJNGGQMLSA-N |
| XLogP | 3.33 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|