C34H29Cl2O6P — CID 122373899
2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxyethyl 4-diphenylphosphanylbenzoate (PubChem CID 122373899) has the molecular formula C34H29Cl2O6P and a molecular weight of 635.48 g/mol. Its IUPAC name is 2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxyethyl 4-diphenylphosphanylbenzoate.
| Compound Name | 2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxyethyl 4-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 122373899 |
| Molecular Formula | C34H29Cl2O6P |
| Molecular Weight | 635.48 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | 2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxyethyl 4-diphenylphosphanylbenzoate |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)OCCOC(=O)c2ccc(P(c3ccccc3)c3ccccc3)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C34H29Cl2O6P/c1-3-23(2)33(38)28-18-19-29(32(36)31(28)35)42-22-30(37)40-20-21-41-34(39)24-14-16-27(17-15-24)43(25-10-6-4-7-11-25)26-12-8-5-9-13-26/h4-19H,2-3,20-22H2,1H3 |
| InChIKey | ZZFPZDYMELCWKU-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|