C17H21Cl2NO3 — CID 166127716
2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]hexanamide (PubChem CID 166127716) has the molecular formula C17H21Cl2NO3 and a molecular weight of 358.27 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]hexanamide.
| Compound Name | 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]hexanamide |
|---|---|
| PubChem CID | 166127716 |
| Molecular Formula | C17H21Cl2NO3 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]hexanamide |
| SMILES | C=C(CC)C(=O)c1ccc(OC(CCCC)C(N)=O)c(Cl)c1Cl |
| InChI | InChI=1S/C17H21Cl2NO3/c1-4-6-7-13(17(20)22)23-12-9-8-11(14(18)15(12)19)16(21)10(3)5-2/h8-9,13H,3-7H2,1-2H3,(H2,20,22) |
| InChIKey | LZNFFITXVMFINC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|