C19H24Cl2O7 — CID 22866475
1-[2,3-dichloro-4-[3-hydroxy-3-[(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]propoxy]phenyl]-2-methylidenebutan-1-one (PubChem CID 22866475) has the molecular formula C19H24Cl2O7 and a molecular weight of 435.30 g/mol. Its IUPAC name is 1-[2,3-dichloro-4-[3-hydroxy-3-[(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]propoxy]phenyl]-2-methylidenebutan-1-one.
| Compound Name | 1-[2,3-dichloro-4-[3-hydroxy-3-[(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]propoxy]phenyl]-2-methylidenebutan-1-one |
|---|---|
| PubChem CID | 22866475 |
| Molecular Formula | C19H24Cl2O7 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 1-[2,3-dichloro-4-[3-hydroxy-3-[(2R,3S,4R,6R)-3,4,6-trihydroxyoxan-2-yl]propoxy]phenyl]-2-methylidenebutan-1-one |
| SMILES | C=C(CC)C(=O)c1ccc(OCCC(O)[C@H]2O[C@@H](O)C[C@@H](O)[C@@H]2O)c(Cl)c1Cl |
| InChI | InChI=1S/C19H24Cl2O7/c1-3-9(2)17(25)10-4-5-13(16(21)15(10)20)27-7-6-11(22)19-18(26)12(23)8-14(24)28-19/h4-5,11-12,14,18-19,22-24,26H,2-3,6-8H2,1H3/t11?,12-,14-,18+,19-/m1/s1 |
| InChIKey | VAEXGSOHXPJADV-CBHZQIDCSA-N |
| XLogP | 2.10 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|