C14H13Cl2NaO4 — CID 23718750
sodium 3-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]propanoate (PubChem CID 23718750) has the molecular formula C14H13Cl2NaO4 and a molecular weight of 339.15 g/mol. Its IUPAC name is sodium 3-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]propanoate.
| Compound Name | sodium 3-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 23718750 |
| Molecular Formula | C14H13Cl2NaO4 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | sodium 3-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]propanoate |
| SMILES | C=C(CC)C(=O)c1ccc(OCCC(=O)[O-])c(Cl)c1Cl.[Na+] |
| InChI | InChI=1S/C14H14Cl2O4.Na/c1-3-8(2)14(19)9-4-5-10(13(16)12(9)15)20-7-6-11(17)18;/h4-5H,2-3,6-7H2,1H3,(H,17,18);/q;+1/p-1 |
| InChIKey | AVETXGFRLCTYII-UHFFFAOYSA-M |
| XLogP | -0.33 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|