C14H17Cl2NO2 — CID 20530620
1-[2,3-dichloro-4-[2-(dimethylamino)ethoxy]phenyl]-2-methylprop-2-en-1-one (PubChem CID 20530620) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-[2,3-dichloro-4-[2-(dimethylamino)ethoxy]phenyl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[2,3-dichloro-4-[2-(dimethylamino)ethoxy]phenyl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 20530620 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 1-[2,3-dichloro-4-[2-(dimethylamino)ethoxy]phenyl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1ccc(OCCN(C)C)c(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl2NO2/c1-9(2)14(18)10-5-6-11(13(16)12(10)15)19-8-7-17(3)4/h5-6H,1,7-8H2,2-4H3 |
| InChIKey | UAPIHUGOVMQOQZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|