C42H51N3O9 — CID 91970397
methyl 5-[3,5-bis[4-[2-(dimethylamino)ethoxy]-3-methoxycarbonylphenyl]phenyl]-2-[2-(dimethylamino)ethoxy]benzoate (PubChem CID 91970397) has the molecular formula C42H51N3O9 and a molecular weight of 741.88 g/mol. Its IUPAC name is methyl 5-[3,5-bis[4-[2-(dimethylamino)ethoxy]-3-methoxycarbonylphenyl]phenyl]-2-[2-(dimethylamino)ethoxy]benzoate.
| Compound Name | methyl 5-[3,5-bis[4-[2-(dimethylamino)ethoxy]-3-methoxycarbonylphenyl]phenyl]-2-[2-(dimethylamino)ethoxy]benzoate |
|---|---|
| PubChem CID | 91970397 |
| Molecular Formula | C42H51N3O9 |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 741.36 |
| IUPAC Name | methyl 5-[3,5-bis[4-[2-(dimethylamino)ethoxy]-3-methoxycarbonylphenyl]phenyl]-2-[2-(dimethylamino)ethoxy]benzoate |
| SMILES | COC(=O)c1cc(-c2cc(-c3ccc(OCCN(C)C)c(C(=O)OC)c3)cc(-c3ccc(OCCN(C)C)c(C(=O)OC)c3)c2)ccc1OCCN(C)C |
| InChI | InChI=1S/C42H51N3O9/c1-43(2)16-19-52-37-13-10-28(25-34(37)40(46)49-7)31-22-32(29-11-14-38(53-20-17-44(3)4)35(26-29)41(47)50-8)24-33(23-31)30-12-15-39(54-21-18-45(5)6)36(27-30)42(48)51-9/h10-15,22-27H,16-21H2,1-9H3 |
| InChIKey | FCDBIBBLNSLEAA-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 116.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|