C21H27NO4 — CID 171661674
methyl 4-[2-[4-[2-(dimethylamino)ethoxy]phenyl]ethyl]-2-methoxybenzoate (PubChem CID 171661674) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 4-[2-[4-[2-(dimethylamino)ethoxy]phenyl]ethyl]-2-methoxybenzoate.
| Compound Name | methyl 4-[2-[4-[2-(dimethylamino)ethoxy]phenyl]ethyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 171661674 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | methyl 4-[2-[4-[2-(dimethylamino)ethoxy]phenyl]ethyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(CCc2ccc(OCCN(C)C)cc2)cc1OC |
| InChI | InChI=1S/C21H27NO4/c1-22(2)13-14-26-18-10-7-16(8-11-18)5-6-17-9-12-19(21(23)25-4)20(15-17)24-3/h7-12,15H,5-6,13-14H2,1-4H3 |
| InChIKey | BQBIRYOHHMNFIJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |