C19H23N3O5 — CID 55857984
N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methoxy-5-nitrobenzamide (PubChem CID 55857984) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methoxy-5-nitrobenzamide.
| Compound Name | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methoxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 55857984 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-2-methoxy-5-nitrobenzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)NCc1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C19H23N3O5/c1-21(2)10-11-27-16-7-4-14(5-8-16)13-20-19(23)17-12-15(22(24)25)6-9-18(17)26-3/h4-9,12H,10-11,13H2,1-3H3,(H,20,23) |
| InChIKey | SHAULGGGYLKLRN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|