C21H24N4O8 — CID 164811834
methyl 2-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]acetate (PubChem CID 164811834) has the molecular formula C21H24N4O8 and a molecular weight of 460.44 g/mol. Its IUPAC name is methyl 2-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]acetate.
| Compound Name | methyl 2-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]acetate |
|---|---|
| PubChem CID | 164811834 |
| Molecular Formula | C21H24N4O8 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl 2-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc([N+](=O)[O-])ccc1OCCN(C)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N4O8/c1-23(10-9-15-3-5-16(6-4-15)24(28)29)11-12-33-19-8-7-17(25(30)31)13-18(19)21(27)22-14-20(26)32-2/h3-8,13H,9-12,14H2,1-2H3,(H,22,27) |
| InChIKey | ZZLONBQFODBYNE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|