C23H28N4O9 — CID 164811832
methyl 3-hydroxy-4-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]butanoate (PubChem CID 164811832) has the molecular formula C23H28N4O9 and a molecular weight of 504.50 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]butanoate.
| Compound Name | methyl 3-hydroxy-4-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]butanoate |
|---|---|
| PubChem CID | 164811832 |
| Molecular Formula | C23H28N4O9 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | methyl 3-hydroxy-4-[[2-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]-5-nitrobenzoyl]amino]butanoate |
| SMILES | COC(=O)CC(O)CNC(=O)c1cc([N+](=O)[O-])ccc1OCCN(C)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H28N4O9/c1-25(10-9-16-3-5-17(6-4-16)26(31)32)11-12-36-21-8-7-18(27(33)34)13-20(21)23(30)24-15-19(28)14-22(29)35-2/h3-8,13,19,28H,9-12,14-15H2,1-2H3,(H,24,30) |
| InChIKey | YIHLELBLRPAURX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 174.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|