C16H23NO8 — CID 2936166
methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]benzoate;oxalic acid (PubChem CID 2936166) has the molecular formula C16H23NO8 and a molecular weight of 357.36 g/mol. Its IUPAC name is methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]benzoate;oxalic acid.
| Compound Name | methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]benzoate;oxalic acid |
|---|---|
| PubChem CID | 2936166 |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | methyl 2-[2-[2-(dimethylamino)ethoxy]ethoxy]benzoate;oxalic acid |
| SMILES | COC(=O)c1ccccc1OCCOCCN(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H21NO4.C2H2O4/c1-15(2)8-9-18-10-11-19-13-7-5-4-6-12(13)14(16)17-3;3-1(4)2(5)6/h4-7H,8-11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | ZMIFNFBBBGBJFV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|