C20H17Cl2NO5 — CID 44570826
4-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]benzoic acid (PubChem CID 44570826) has the molecular formula C20H17Cl2NO5 and a molecular weight of 422.26 g/mol. Its IUPAC name is 4-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 44570826 |
| Molecular Formula | C20H17Cl2NO5 |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 4-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]benzoic acid |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)Nc2ccc(C(=O)O)cc2)c(Cl)c1Cl |
| InChI | InChI=1S/C20H17Cl2NO5/c1-3-11(2)19(25)14-8-9-15(18(22)17(14)21)28-10-16(24)23-13-6-4-12(5-7-13)20(26)27/h4-9H,2-3,10H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | ZQAWAWDGSTVVSS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|