C19H17Cl2N3O6S — CID 44571045
(2E)-2-[2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid (PubChem CID 44571045) has the molecular formula C19H17Cl2N3O6S and a molecular weight of 486.33 g/mol. Its IUPAC name is (2E)-2-[2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid.
| Compound Name | (2E)-2-[2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 44571045 |
| Molecular Formula | C19H17Cl2N3O6S |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | (2E)-2-[2-[[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetic acid |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)Nc2nc(/C(=N\OC)C(=O)O)cs2)c(Cl)c1Cl |
| InChI | InChI=1S/C19H17Cl2N3O6S/c1-4-9(2)17(26)10-5-6-12(15(21)14(10)20)30-7-13(25)23-19-22-11(8-31-19)16(18(27)28)24-29-3/h5-6,8H,2,4,7H2,1,3H3,(H,27,28)(H,22,23,25)/b24-16+ |
| InChIKey | VNTXQJKUJXSTBH-LFVJCYFKSA-N |
| XLogP | 4.05 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|