C22H24Cl2O10 — CID 155159252
2-[2-[2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyloxy]propanoyloxy]propanoic acid (PubChem CID 155159252) has the molecular formula C22H24Cl2O10 and a molecular weight of 519.33 g/mol. Its IUPAC name is 2-[2-[2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyloxy]propanoyloxy]propanoic acid.
| Compound Name | 2-[2-[2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyloxy]propanoyloxy]propanoic acid |
|---|---|
| PubChem CID | 155159252 |
| Molecular Formula | C22H24Cl2O10 |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 2-[2-[2-[2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetyl]oxypropanoyloxy]propanoyloxy]propanoic acid |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)OC(C)C(=O)OC(C)C(=O)OC(C)C(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C22H24Cl2O10/c1-6-10(2)19(26)14-7-8-15(18(24)17(14)23)31-9-16(25)32-12(4)21(29)34-13(5)22(30)33-11(3)20(27)28/h7-8,11-13H,2,6,9H2,1,3-5H3,(H,27,28) |
| InChIKey | LBPIPUJZXQNZSA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|