C16H18Cl2O6 — CID 11559860
2,3-dihydroxypropyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate (PubChem CID 11559860) has the molecular formula C16H18Cl2O6 and a molecular weight of 377.22 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate.
| Compound Name | 2,3-dihydroxypropyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate |
|---|---|
| PubChem CID | 11559860 |
| Molecular Formula | C16H18Cl2O6 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2,3-dihydroxypropyl 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetate |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)OCC(O)CO)c(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl2O6/c1-3-9(2)16(22)11-4-5-12(15(18)14(11)17)23-8-13(21)24-7-10(20)6-19/h4-5,10,19-20H,2-3,6-8H2,1H3 |
| InChIKey | PKYSNQRXFXPXGU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|