C16H23NO5 — CID 2104071
methyl 2-(3,3-dimethylbutanoylamino)-4,5-dimethoxybenzoate (PubChem CID 2104071) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is methyl 2-(3,3-dimethylbutanoylamino)-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-(3,3-dimethylbutanoylamino)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2104071 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl 2-(3,3-dimethylbutanoylamino)-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H23NO5/c1-16(2,3)9-14(18)17-11-8-13(21-5)12(20-4)7-10(11)15(19)22-6/h7-8H,9H2,1-6H3,(H,17,18) |
| InChIKey | POQJTUXGEAXDSE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |