C15H21NO7 — CID 19849627
methyl 2-(2,2-dimethoxypropanoylamino)-4,5-dimethoxybenzoate (PubChem CID 19849627) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is methyl 2-(2,2-dimethoxypropanoylamino)-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-(2,2-dimethoxypropanoylamino)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 19849627 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl 2-(2,2-dimethoxypropanoylamino)-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)C(C)(OC)OC |
| InChI | InChI=1S/C15H21NO7/c1-15(22-5,23-6)14(18)16-10-8-12(20-3)11(19-2)7-9(10)13(17)21-4/h7-8H,1-6H3,(H,16,18) |
| InChIKey | DABXQFWXOSHIOQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|