C12H15BrO2 — CID 15354623
6-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 15354623) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is 6-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 15354623 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 6-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc(Br)c(OC)c2c1CCCC2 |
| InChI | InChI=1S/C12H15BrO2/c1-14-11-7-10(13)12(15-2)9-6-4-3-5-8(9)11/h7H,3-6H2,1-2H3 |
| InChIKey | WNLUFKIRXBJTPT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |