C12H15BrO3 — CID 105057504
(1S)-7-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 105057504) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is (1S)-7-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1S)-7-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 105057504 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (1S)-7-bromo-5,8-dimethoxy-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | COc1cc(Br)c(OC)c2c1CCC[C@@H]2O |
| InChI | InChI=1S/C12H15BrO3/c1-15-10-6-8(13)12(16-2)11-7(10)4-3-5-9(11)14/h6,9,14H,3-5H2,1-2H3/t9-/m0/s1 |
| InChIKey | PACDBZKSGYQMPE-VIFPVBQESA-N |
| XLogP | 2.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |