About 3-bromo-4,7-dimethoxy-1H-indole
3-bromo-4,7-dimethoxy-1H-indole (PubChem CID 13285273) has the molecular formula C10H10BrNO2
and a molecular weight of 256.10 g/mol. Its IUPAC name is 3-bromo-4,7-dimethoxy-1H-indole.
Molecular Properties
| Compound Name | 3-bromo-4,7-dimethoxy-1H-indole |
| PubChem CID | 13285273 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 3-bromo-4,7-dimethoxy-1H-indole |
| SMILES | COc1ccc(OC)c2c(Br)c[nH]c12 |
| InChI | InChI=1S/C10H10BrNO2/c1-13-7-3-4-8(14-2)10-9(7)6(11)5-12-10/h3-5,12H,1-2H3 |
| InChIKey | NNMGXOGXPJPWIY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-4,7-dimethoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4,7-dimethoxy-1H-indole?
The IUPAC name of 3-bromo-4,7-dimethoxy-1H-indole (CID 13285273) is 3-bromo-4,7-dimethoxy-1H-indole.
What is the SMILES notation for 3-bromo-4,7-dimethoxy-1H-indole?
The canonical SMILES for 3-bromo-4,7-dimethoxy-1H-indole is COc1ccc(OC)c2c(Br)c[nH]c12.
What is the InChIKey of 3-bromo-4,7-dimethoxy-1H-indole?
The InChIKey is NNMGXOGXPJPWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2/c1-13-7-3-4-8(14-2)10-9(7)6(11)5-12-10/h3-5,12H,1-2H3.
What are the key properties of 3-bromo-4,7-dimethoxy-1H-indole?
3-bromo-4,7-dimethoxy-1H-indole has a molecular weight of 256.10 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4,7-dimethoxy-1H-indole is sourced from PubChem (CID 13285273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).