C13H11BrO6 — CID 134911721
6-bromo-5,7,8-trimethoxy-2-oxochromene-3-carbaldehyde (PubChem CID 134911721) has the molecular formula C13H11BrO6 and a molecular weight of 343.13 g/mol. Its IUPAC name is 6-bromo-5,7,8-trimethoxy-2-oxochromene-3-carbaldehyde.
| Compound Name | 6-bromo-5,7,8-trimethoxy-2-oxochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 134911721 |
| Molecular Formula | C13H11BrO6 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 6-bromo-5,7,8-trimethoxy-2-oxochromene-3-carbaldehyde |
| SMILES | COc1c(Br)c(OC)c2cc(C=O)c(=O)oc2c1OC |
| InChI | InChI=1S/C13H11BrO6/c1-17-9-7-4-6(5-15)13(16)20-10(7)12(19-3)11(18-2)8(9)14/h4-5H,1-3H3 |
| InChIKey | UAHAFVWMBKSJPL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|