About 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde
6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde (PubChem CID 25194733) has the molecular formula C10H7BrCl2O3
and a molecular weight of 325.97 g/mol. Its IUPAC name is 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde |
| PubChem CID | 25194733 |
| Molecular Formula | C10H7BrCl2O3 |
| Molecular Weight | 325.97 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde |
| SMILES | COc1ccc(Br)c(C=O)c1O/C(Cl)=C\Cl |
| InChI | InChI=1S/C10H7BrCl2O3/c1-15-8-3-2-7(11)6(5-14)10(8)16-9(13)4-12/h2-5H,1H3/b9-4- |
| InChIKey | WNUJNFCRDZFLGE-WTKPLQERSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.97 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde?
The IUPAC name of 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde (CID 25194733) is 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde.
What is the SMILES notation for 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde?
The canonical SMILES for 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde is COc1ccc(Br)c(C=O)c1O/C(Cl)=C\Cl.
What is the InChIKey of 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde?
The InChIKey is WNUJNFCRDZFLGE-WTKPLQERSA-N. The full InChI is InChI=1S/C10H7BrCl2O3/c1-15-8-3-2-7(11)6(5-14)10(8)16-9(13)4-12/h2-5H,1H3/b9-4-.
What are the key properties of 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde?
6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde has a molecular weight of 325.97 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde is sourced from PubChem (CID 25194733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).