C10H7BrCl2O3 — CID 25194733
6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde (PubChem CID 25194733) has the molecular formula C10H7BrCl2O3 and a molecular weight of 325.97 g/mol. Its IUPAC name is 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde.
| Compound Name | 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 25194733 |
| Molecular Formula | C10H7BrCl2O3 |
| Molecular Weight | 325.97 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | 6-bromo-2-[(E)-1,2-dichloroethenoxy]-3-methoxybenzaldehyde |
| SMILES | COc1ccc(Br)c(C=O)c1O/C(Cl)=C\Cl |
| InChI | InChI=1S/C10H7BrCl2O3/c1-15-8-3-2-7(11)6(5-14)10(8)16-9(13)4-12/h2-5H,1H3/b9-4- |
| InChIKey | WNUJNFCRDZFLGE-WTKPLQERSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.97 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|