C9H10Cl2FNO — CID 83897923
1-(2,5-dichloro-3-fluoro-6-methoxyphenyl)-N-methylmethanamine (PubChem CID 83897923) has the molecular formula C9H10Cl2FNO and a molecular weight of 238.09 g/mol. Its IUPAC name is 1-(2,5-dichloro-3-fluoro-6-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(2,5-dichloro-3-fluoro-6-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83897923 |
| Molecular Formula | C9H10Cl2FNO |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 1-(2,5-dichloro-3-fluoro-6-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNCc1c(Cl)c(F)cc(Cl)c1OC |
| InChI | InChI=1S/C9H10Cl2FNO/c1-13-4-5-8(11)7(12)3-6(10)9(5)14-2/h3,13H,4H2,1-2H3 |
| InChIKey | XKUASBXEDSNFMC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|