C22H28O3 — CID 19819063
2-(3-hydroxy-3-methylpent-4-enyl)-3,5,6-trimethyl-4-phenylmethoxyphenol (PubChem CID 19819063) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylpent-4-enyl)-3,5,6-trimethyl-4-phenylmethoxyphenol.
| Compound Name | 2-(3-hydroxy-3-methylpent-4-enyl)-3,5,6-trimethyl-4-phenylmethoxyphenol |
|---|---|
| PubChem CID | 19819063 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-(3-hydroxy-3-methylpent-4-enyl)-3,5,6-trimethyl-4-phenylmethoxyphenol |
| SMILES | C=CC(C)(O)CCc1c(C)c(OCc2ccccc2)c(C)c(C)c1O |
| InChI | InChI=1S/C22H28O3/c1-6-22(5,24)13-12-19-17(4)21(16(3)15(2)20(19)23)25-14-18-10-8-7-9-11-18/h6-11,23-24H,1,12-14H2,2-5H3 |
| InChIKey | JQCUWIRRBINDHU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|