C23H28O — CID 170000022
1-hepta-1,6-dien-4-yl-3,4,5-trimethyl-2-phenylmethoxybenzene (PubChem CID 170000022) has the molecular formula C23H28O and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-hepta-1,6-dien-4-yl-3,4,5-trimethyl-2-phenylmethoxybenzene.
| Compound Name | 1-hepta-1,6-dien-4-yl-3,4,5-trimethyl-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 170000022 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-hepta-1,6-dien-4-yl-3,4,5-trimethyl-2-phenylmethoxybenzene |
| SMILES | C=CCC(CC=C)c1cc(C)c(C)c(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H28O/c1-6-11-21(12-7-2)22-15-17(3)18(4)19(5)23(22)24-16-20-13-9-8-10-14-20/h6-10,13-15,21H,1-2,11-12,16H2,3-5H3 |
| InChIKey | XNUPONHXJUKRTL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|