C21H20O — CID 175309090
1,2-dimethyl-5-phenyl-3-phenylmethoxybenzene (PubChem CID 175309090) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,2-dimethyl-5-phenyl-3-phenylmethoxybenzene.
| Compound Name | 1,2-dimethyl-5-phenyl-3-phenylmethoxybenzene |
|---|---|
| PubChem CID | 175309090 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1,2-dimethyl-5-phenyl-3-phenylmethoxybenzene |
| SMILES | Cc1cc(-c2ccccc2)cc(OCc2ccccc2)c1C |
| InChI | InChI=1S/C21H20O/c1-16-13-20(19-11-7-4-8-12-19)14-21(17(16)2)22-15-18-9-5-3-6-10-18/h3-14H,15H2,1-2H3 |
| InChIKey | HGSYRDTVHSNFQT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |