C20H20OS — CID 18718071
3-(2,3,4-trimethyl-6-phenylmethoxyphenyl)thiophene (PubChem CID 18718071) has the molecular formula C20H20OS and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-(2,3,4-trimethyl-6-phenylmethoxyphenyl)thiophene.
| Compound Name | 3-(2,3,4-trimethyl-6-phenylmethoxyphenyl)thiophene |
|---|---|
| PubChem CID | 18718071 |
| Molecular Formula | C20H20OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-(2,3,4-trimethyl-6-phenylmethoxyphenyl)thiophene |
| SMILES | Cc1cc(OCc2ccccc2)c(-c2ccsc2)c(C)c1C |
| InChI | InChI=1S/C20H20OS/c1-14-11-19(21-12-17-7-5-4-6-8-17)20(16(3)15(14)2)18-9-10-22-13-18/h4-11,13H,12H2,1-3H3 |
| InChIKey | RTLALAOYBPGEBQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |