C14H15NO — CID 70023630
3,4-dimethyl-5-phenylmethoxypyridine (PubChem CID 70023630) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 3,4-dimethyl-5-phenylmethoxypyridine.
| Compound Name | 3,4-dimethyl-5-phenylmethoxypyridine |
|---|---|
| PubChem CID | 70023630 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3,4-dimethyl-5-phenylmethoxypyridine |
| SMILES | Cc1cncc(OCc2ccccc2)c1C |
| InChI | InChI=1S/C14H15NO/c1-11-8-15-9-14(12(11)2)16-10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | QTTRKTXPHUQLKA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |