4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid

C16H18FNO3 — CID 175513223

IUPAC4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid
SMILESCCC(=O)O.Cc1cncc(OCc2ccccc2)c1F
InChIInChI=1S/C13H12FNO.C3H6O2/c1-10-7-15-8-12(13(10)14)16-9-11-5-3-2-4-6-11;1-2-3(4)5/h2-8H,9H2,1H3;2H2,1H3,(H,4,5)
InChIKeyOSJSEORLWOUNPS-UHFFFAOYSA-N
MW291.32 g/mol
LogP3.59
Rot. Bonds4

About 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid

4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid (PubChem CID 175513223) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid.

Molecular Properties

Compound Name4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid
PubChem CID175513223
Molecular FormulaC16H18FNO3
Molecular Weight291.32 g/mol
Exact Mass291.13
IUPAC Name4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid
SMILESCCC(=O)O.Cc1cncc(OCc2ccccc2)c1F
InChIInChI=1S/C13H12FNO.C3H6O2/c1-10-7-15-8-12(13(10)14)16-9-11-5-3-2-4-6-11;1-2-3(4)5/h2-8H,9H2,1H3;2H2,1H3,(H,4,5)
InChIKeyOSJSEORLWOUNPS-UHFFFAOYSA-N
XLogP3.59
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.32
LogP ≤ 53.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
The IUPAC name of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid (CID 175513223) is 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid.
What is the SMILES notation for 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
The canonical SMILES for 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid is CCC(=O)O.Cc1cncc(OCc2ccccc2)c1F.
What is the InChIKey of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
The InChIKey is OSJSEORLWOUNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO.C3H6O2/c1-10-7-15-8-12(13(10)14)16-9-11-5-3-2-4-6-11;1-2-3(4)5/h2-8H,9H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid has a molecular weight of 291.32 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid is sourced from PubChem (CID 175513223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).