About 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid
4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid (PubChem CID 175513223) has the molecular formula C16H18FNO3
and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid.
Molecular Properties
| Compound Name | 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid |
| PubChem CID | 175513223 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid |
| SMILES | CCC(=O)O.Cc1cncc(OCc2ccccc2)c1F |
| InChI | InChI=1S/C13H12FNO.C3H6O2/c1-10-7-15-8-12(13(10)14)16-9-11-5-3-2-4-6-11;1-2-3(4)5/h2-8H,9H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | OSJSEORLWOUNPS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
The IUPAC name of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid (CID 175513223) is 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid.
What is the SMILES notation for 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
The canonical SMILES for 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid is CCC(=O)O.Cc1cncc(OCc2ccccc2)c1F.
What is the InChIKey of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
The InChIKey is OSJSEORLWOUNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO.C3H6O2/c1-10-7-15-8-12(13(10)14)16-9-11-5-3-2-4-6-11;1-2-3(4)5/h2-8H,9H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid?
4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid has a molecular weight of 291.32 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-methyl-5-phenylmethoxypyridine;propanoic acid is sourced from PubChem (CID 175513223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).