C24H30O2 — CID 24895083
1-methyl-5-(2-methylbut-3-en-2-yloxy)-4-pent-4-en-2-yl-2-phenylmethoxybenzene (PubChem CID 24895083) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is 1-methyl-5-(2-methylbut-3-en-2-yloxy)-4-pent-4-en-2-yl-2-phenylmethoxybenzene.
| Compound Name | 1-methyl-5-(2-methylbut-3-en-2-yloxy)-4-pent-4-en-2-yl-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 24895083 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-methyl-5-(2-methylbut-3-en-2-yloxy)-4-pent-4-en-2-yl-2-phenylmethoxybenzene |
| SMILES | C=CCC(C)c1cc(OCc2ccccc2)c(C)cc1OC(C)(C)C=C |
| InChI | InChI=1S/C24H30O2/c1-7-12-18(3)21-16-22(25-17-20-13-10-9-11-14-20)19(4)15-23(21)26-24(5,6)8-2/h7-11,13-16,18H,1-2,12,17H2,3-6H3 |
| InChIKey | GVDNUZCLMDXBEA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|