C20H25IO3 — CID 166169617
(2,3,5-trimethyl-4-phenylmethoxy-6-propylphenoxy)methyl hypoiodite (PubChem CID 166169617) has the molecular formula C20H25IO3 and a molecular weight of 440.32 g/mol. Its IUPAC name is (2,3,5-trimethyl-4-phenylmethoxy-6-propylphenoxy)methyl hypoiodite.
| Compound Name | (2,3,5-trimethyl-4-phenylmethoxy-6-propylphenoxy)methyl hypoiodite |
|---|---|
| PubChem CID | 166169617 |
| Molecular Formula | C20H25IO3 |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (2,3,5-trimethyl-4-phenylmethoxy-6-propylphenoxy)methyl hypoiodite |
| SMILES | CCCc1c(C)c(OCc2ccccc2)c(C)c(C)c1OCOI |
| InChI | InChI=1S/C20H25IO3/c1-5-9-18-16(4)19(22-12-17-10-7-6-8-11-17)14(2)15(3)20(18)23-13-24-21/h6-8,10-11H,5,9,12-13H2,1-4H3 |
| InChIKey | IKDMSZLKSUOYON-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|