About 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol
6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol (PubChem CID 174745981) has the molecular formula C27H24O5
and a molecular weight of 428.48 g/mol. Its IUPAC name is 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol.
Molecular Properties
| Compound Name | 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol |
| PubChem CID | 174745981 |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol |
| SMILES | O=C(O)c1c(O)ccc(-c2ccccc2)c1OCc1ccccc1.OCc1ccccc1 |
| InChI | InChI=1S/C20H16O4.C7H8O/c21-17-12-11-16(15-9-5-2-6-10-15)19(18(17)20(22)23)24-13-14-7-3-1-4-8-14;8-6-7-4-2-1-3-5-7/h1-12,21H,13H2,(H,22,23);1-5,8H,6H2 |
| InChIKey | FEICUENTVCQVNY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol?
The IUPAC name of 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol (CID 174745981) is 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol.
What is the SMILES notation for 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol?
The canonical SMILES for 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol is O=C(O)c1c(O)ccc(-c2ccccc2)c1OCc1ccccc1.OCc1ccccc1.
What is the InChIKey of 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol?
The InChIKey is FEICUENTVCQVNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O4.C7H8O/c21-17-12-11-16(15-9-5-2-6-10-15)19(18(17)20(22)23)24-13-14-7-3-1-4-8-14;8-6-7-4-2-1-3-5-7/h1-12,21H,13H2,(H,22,23);1-5,8H,6H2.
What are the key properties of 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol?
6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol has a molecular weight of 428.48 g/mol, XLogP of 5.52, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3-phenyl-2-phenylmethoxybenzoic acid;phenylmethanol is sourced from PubChem (CID 174745981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).