C18H13ClF5NO5S — CID 135257608
benzyl (3S)-4-chloro-3-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-oxobutanoate (PubChem CID 135257608) has the molecular formula C18H13ClF5NO5S and a molecular weight of 485.81 g/mol. Its IUPAC name is benzyl (3S)-4-chloro-3-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-oxobutanoate.
| Compound Name | benzyl (3S)-4-chloro-3-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 135257608 |
| Molecular Formula | C18H13ClF5NO5S |
| Molecular Weight | 485.81 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | benzyl (3S)-4-chloro-3-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-4-oxobutanoate |
| SMILES | CN([C@@H](CC(=O)OCc1ccccc1)C(=O)Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H13ClF5NO5S/c1-25(31(28,29)17-15(23)13(21)12(20)14(22)16(17)24)10(18(19)27)7-11(26)30-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m0/s1 |
| InChIKey | YZWAJPPCLOBGCJ-JTQLQIEISA-N |
| XLogP | 3.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|