C9H9F2NO4S — CID 43237883
2-[(2,6-difluorophenyl)sulfonyl-methylamino]acetic acid (PubChem CID 43237883) has the molecular formula C9H9F2NO4S and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)sulfonyl-methylamino]acetic acid.
| Compound Name | 2-[(2,6-difluorophenyl)sulfonyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 43237883 |
| Molecular Formula | C9H9F2NO4S |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-[(2,6-difluorophenyl)sulfonyl-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)S(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C9H9F2NO4S/c1-12(5-8(13)14)17(15,16)9-6(10)3-2-4-7(9)11/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | OECSNVHDYJSHFS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |