C40H35F5N2O6S — CID 126744089
benzyl 4-[[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoate (PubChem CID 126744089) has the molecular formula C40H35F5N2O6S and a molecular weight of 766.79 g/mol. Its IUPAC name is benzyl 4-[[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoate.
| Compound Name | benzyl 4-[[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 126744089 |
| Molecular Formula | C40H35F5N2O6S |
| Molecular Weight | 766.79 g/mol |
| Exact Mass | 766.21 |
| IUPAC Name | benzyl 4-[[2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]acetyl]-[(2,3,4,5,6-pentafluorophenyl)methyl]amino]-2-phenylmethoxybenzoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C)CC(=O)N(Cc2c(F)c(F)c(F)c(F)c2F)c2ccc(C(=O)OCc3ccccc3)c(OCc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C40H35F5N2O6S/c1-24-17-25(2)39(26(3)18-24)54(50,51)46(4)21-33(48)47(20-31-34(41)36(43)38(45)37(44)35(31)42)29-15-16-30(40(49)53-23-28-13-9-6-10-14-28)32(19-29)52-22-27-11-7-5-8-12-27/h5-19H,20-23H2,1-4H3 |
| InChIKey | PWTPXVJPEYUROE-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.79 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|